CAS 104227-87-4: Famciclovir
Description:Famciclovir is an antiviral medication primarily used to treat infections caused by certain types of viruses, particularly herpes viruses, including herpes zoster (shingles) and genital herpes. It is a prodrug of penciclovir, meaning that it is metabolized in the body to its active form. Famciclovir is characterized by its chemical formula, which reflects its structure as a purine nucleoside analogue. The substance is typically administered orally and is known for its good bioavailability and relatively long half-life, allowing for less frequent dosing compared to some other antiviral agents. Famciclovir exhibits a mechanism of action that involves selective inhibition of viral DNA synthesis, thereby preventing the replication of the virus. It is generally well-tolerated, with side effects that may include headache, nausea, and diarrhea. As with any medication, it is important to use famciclovir under the guidance of a healthcare professional to ensure appropriate use and to monitor for potential interactions with other medications.
Formula:C14H19N5O4
InChI:InChI=1S/C14H19N5O4/c1-9(20)22-6-11(7-23-10(2)21)3-4-19-8-17-12-5-16-14(15)18-13(12)19/h5,8,11H,3-4,6-7H2,1-2H3,(H2,15,16,18)
InChI key:InChIKey=GGXKWVWZWMLJEH-UHFFFAOYSA-N
SMILES:O=C(OCC(COC(=O)C)CCN1C=NC=2C=NC(=NC21)N)C
- Synonyms:
- 1,3-Propanediol, 2-[2-(2-amino-9H-purin-9-yl)ethyl]-, diacetate (ester)
- BRL 42810
- Famvir
- Famciclovir
- 1,3-Propanediol, 2-[2-(2-amino-9H-purin-9-yl)ethyl]-, 1,3-diacetate
