CAS 104253-44-3
:2-CHLORO-4-HYDROXY-BENZOIC ACID METHYL ESTER
Description:
2-Chloro-4-hydroxybenzoic acid methyl ester, with the CAS number 104253-44-3, is an organic compound characterized by its aromatic structure, which includes a chloro substituent and a hydroxyl group on the benzene ring, along with a methyl ester functional group. This compound typically appears as a white to off-white solid and is soluble in organic solvents, reflecting its hydrophobic characteristics due to the aromatic ring. The presence of the hydroxyl group contributes to its potential as a weak acid, while the methyl ester group enhances its reactivity in various chemical reactions, such as esterification and nucleophilic substitutions. It is often used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Additionally, its chlorinated structure may impart specific biological activities, making it of interest in medicinal chemistry. Safety data should be consulted for handling and potential toxicity, as chlorinated compounds can exhibit varying degrees of environmental persistence and biological effects.
Formula:C8H7ClO3
InChI:InChI=1/C8H7ClO3/c1-12-8(11)6-3-2-5(10)4-7(6)9/h2-4,10H,1H3
SMILES:COC(=O)c1ccc(cc1Cl)O
Synonyms:- Methyl 2-Chloro-4-Hydroxybenzoate
- Rarechem Al Bf 0717
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Methyl 2-chloro-4-hydroxybenzoate
CAS:Formula:C8H7ClO3Purity:98%Color and Shape:SolidMolecular weight:186.5924Methyl 2-chloro-4-hydroxybenzoate
CAS:Methyl 2-chloro-4-hydroxybenzoateFormula:C8H7ClO3Purity:98%Molecular weight:186.592-Chloro-4-hydroxy-benzoic acid methyl ester
CAS:2-Chloro-4-hydroxy-benzoic acid methyl esterFormula:C8H7ClO3Purity:95%Color and Shape:SolidMolecular weight:186.592372-Chloro-4-hydroxybenzoic acid methyl ester
CAS:2-Chloro-4-hydroxybenzoic acid methyl ester is a white crystalline solid at room temperature. It is soluble in water and ethanol and has a melting point of 137°C. 2-Chloro-4-hydroxybenzoic acid methyl ester can be used as a versatile building block for the synthesis of fine chemicals, useful intermediates, research chemicals, reaction components, specialty chemicals, and complex compounds. It can also be used as a reagent to prepare other compounds.Formula:C8H7ClO3Purity:Min. 95%Color and Shape:PowderMolecular weight:186.59 g/molMethyl 2-chloro-4-hydroxybenzoate
CAS:Formula:C8H7ClO3Purity:98%Color and Shape:Solid, No data available.Molecular weight:186.59




