CAS 104253-45-4
:Benzoic acid, 2-chloro-4-methoxy-, methyl ester
Description:
Benzoic acid, 2-chloro-4-methoxy-, methyl ester, also known by its CAS number 104253-45-4, is an organic compound characterized by its ester functional group derived from benzoic acid. This compound features a methoxy group (-OCH3) and a chloro substituent (-Cl) on the aromatic ring, which influence its chemical reactivity and physical properties. Typically, it appears as a colorless to pale yellow liquid or solid, depending on the specific conditions. The presence of the chloro and methoxy groups can enhance its solubility in organic solvents while potentially affecting its polarity. This compound may exhibit biological activity, making it of interest in various fields, including pharmaceuticals and agrochemicals. Its synthesis often involves the esterification of benzoic acid derivatives, and it may be utilized in research for its potential applications in organic synthesis or as an intermediate in the production of other chemical entities. Safety data should be consulted for handling and storage, as halogenated compounds can pose environmental and health risks.
Formula:C9H9ClO3
InChI:InChI=1S/C9H9ClO3/c1-12-6-3-4-7(8(10)5-6)9(11)13-2/h3-5H,1-2H3
InChI key:InChIKey=VXORHTLUPYQIFE-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=C(Cl)C=C(OC)C=C1
Synonyms:- Methyl 2-chloro-4-methoxybenzoate
- 2-Chloro-4-methoxybenzoic acid methyl ester
- Benzoic acid, 2-chloro-4-methoxy-, methyl ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Methyl 2-chloro-4-methoxybenzoate
CAS:Methyl 2-chloro-4-methoxybenzoateFormula:C9H9ClO3Purity:99+%Molecular weight:200.61896Benzoic acid,2-chloro-4-methoxy-, methyl ester
CAS:Formula:C9H9ClO3Purity:98%Color and Shape:SolidMolecular weight:200.61902-Chloro-4-methoxybenzoic acid methyl ester
CAS:2-Chloro-4-methoxybenzoic acid methyl ester is a reagent that can be used in the preparation of various compounds. It is also a versatile building block for the synthesis of complex compounds, such as pharmaceuticals and agrochemicals. This chemical is often used as an intermediate or building block in the preparation of pharmaceuticals and agrochemicals. 2-Chloro-4-methoxybenzoic acid methyl ester has been shown to be a useful scaffold for the synthesis of drugs with high quality and low cost.Formula:C9H9ClO3Purity:Min. 95%Color and Shape:PowderMolecular weight:200.62 g/molMethyl 2-chloro-4-methoxybenzoate
CAS:Methyl 2-chloro-4-methoxybenzoateFormula:C9H9ClO3Purity:99+%Molecular weight:200.62Methyl 2-chloro-4-methoxybenzoate
CAS:Methyl 2-chloro-4-methoxybenzoateFormula:C9H9ClO3Purity:98%Molecular weight:200.62




