CymitQuimica logo

CAS 104305-93-3

:

Diphpetmednp

Description:
Diphpetmednp, with the CAS number 104305-93-3, is a chemical compound that belongs to the class of diphosphate esters. It is characterized by its unique molecular structure, which includes two phosphate groups linked to a central carbon framework. This compound is often studied for its potential applications in various fields, including biochemistry and materials science. Diphpetmednp may exhibit properties such as solubility in organic solvents, stability under specific conditions, and reactivity with nucleophiles, making it of interest for synthetic chemistry. Its role as a potential reagent or intermediate in chemical reactions can also be explored. However, detailed information regarding its specific physical and chemical properties, such as melting point, boiling point, and spectral data, would typically be found in specialized chemical databases or literature. As with any chemical substance, safety data sheets should be consulted to understand its handling, storage, and potential hazards.
Formula:C35H36N4O6
InChI:InChI=1/C35H36N4O6/c1-24-30(34(40)44-3)32(28-15-10-16-29(23-28)39(42)43)31(25(2)36-24)35(41)45-22-21-37-17-19-38(20-18-37)33(26-11-6-4-7-12-26)27-13-8-5-9-14-27/h4-16,23,33H,17-22H2,1-3H3
SMILES:Cc1c(c(c2cccc(c2)N(=O)=O)c(c(C)n1)C(=O)OCCN1CCN(CC1)C(c1ccccc1)c1ccccc1)C(=O)OC
Synonyms:
  • 2-(4-(Diphenylmethyl)-1-Piperazinyl)Ethylmethyl-2,6-Dimethyl-4-(3-Nitrophenyl)-3,5-Pyridinedicarboxylate
  • 2-[4-(Diphenylmethyl)Piperazin-1-Yl]Ethyl Methyl 2,6-Dimethyl-4-(3-Nitrophenyl)Pyridine-3,5-Dicarboxylate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.