CAS 10436-08-5
:cis-11-Eicosenamide
Description:
Cis-11-Eicosenamide, with the CAS number 10436-08-5, is a long-chain fatty amide characterized by its unsaturated structure, featuring a cis double bond at the 11th carbon position of the eicosane backbone. This compound is derived from eicosenoic acid and is typically found in various natural sources, including certain plant oils. It exhibits properties common to fatty amides, such as being a waxy solid at room temperature and having low solubility in water due to its hydrophobic nature. Cis-11-Eicosenamide is of interest in various fields, including biochemistry and materials science, due to its potential applications in surfactants, emulsifiers, and as a lubricant. Additionally, its unique structural features may contribute to specific biological activities, making it a subject of research in pharmacology and nutrition. The compound's stability and reactivity can be influenced by the presence of the double bond, which may participate in further chemical reactions under appropriate conditions.
Formula:C20H39NO
InChI:InChI=1/C20H39NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22/h9-10H,2-8,11-19H2,1H3,(H2,21,22)/b10-9-
SMILES:CCCCCCCC/C=C\CCCCCCCCCC(=N)O
Synonyms:- (Z)-11-Eicosenamide
- (11Z)-icos-11-enamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
(11Z)-11-Eicosenamide ((Z)-icos-11-enamide)
CAS:Acyclic amides (including acyclic carbamates) and their derivatives and salts thereof, nesoiFormula:C20H39NOColor and Shape:Off-White SolidMolecular weight:309.30316cis-11-Eicosenamide
CAS:cis-11-Eicosenamide is a carbonyl amide that belongs to the class of aliphatic hydrocarbons. It has reactive properties, which can be beneficial as corrosion inhibitors in automotive products. cis-11-Eicosenamide also has antibacterial activity and is used as an additive in polyvalent coatings. cis-11-Eicosenamide is used in tests with test organisms such as the fungus Candida albicans and Escherichia coli. The chemical composition of cis-11-Eicosenamide includes a carbonyl group, an amide, and a fatty acid.Formula:C20H39NOPurity:Min. 95%Color and Shape:PowderMolecular weight:309.53 g/mol






