CAS 104375-88-4
:5'-O-(DIMETHOXYTRITYL)-5-IODO-2'-DEOXYURIDINE
Description:
5'-O-(Dimethoxytrityl)-5-iodo-2'-deoxyuridine is a modified nucleoside that plays a significant role in nucleic acid chemistry, particularly in the synthesis of oligonucleotides. This compound features a deoxyuridine base, which is a nucleoside composed of a pyrimidine base (uridine) linked to a deoxyribose sugar. The presence of the dimethoxytrityl (DMT) protecting group at the 5' position enhances the stability and solubility of the molecule, making it suitable for use in solid-phase synthesis of DNA. The iodine substitution at the 5' position introduces a halogen that can be utilized for further chemical modifications or reactions, such as coupling with other nucleotides. This compound is typically used in research and pharmaceutical applications, particularly in the development of antisense oligonucleotides and other nucleic acid-based therapeutics. Its unique structural features contribute to its utility in various biochemical applications, including gene therapy and molecular diagnostics.
Formula:C30H29IN2O7
InChI:InChI=1S/C30H29IN2O7/c1-37-22-12-8-20(9-13-22)30(19-6-4-3-5-7-19,21-10-14-23(38-2)15-11-21)39-18-26-25(34)16-27(40-26)33-17-24(31)28(35)32-29(33)36/h3-15,17,25-27,34H,16,18H2,1-2H3,(H,32,35,36)/t25-,26+,27+/m0/s1
InChI key:RLDUYGSOCGOJTP-OYUWMTPXSA-N
SMILES:COC1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=C(C=C3)OC)OC[C@@H]4[C@H](C[C@@H](O4)N5C=C(C(=O)NC5=O)I)O
Synonyms:- 5'-O-DMTr-5-Iodo-2'-deoxyuridine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
1-((2R,4S,5R)-5-((Bis(4-methoxyphenyl)(phenyl)methoxy)methyl)-4-hydroxytetrahydrofuran-2-yl)-5-iodopyrimidine-2,4(1H,3H)-dione
CAS:Formula:C30H29IN2O7Purity:95%Color and Shape:SolidMolecular weight:656.46491-((2R,4S,5R)-5-((Bis(4-methoxyphenyl)(phenyl)methoxy)methyl)-4-hydroxytetrahydrofuran-2-yl)-5-iodopyrimidine-2,4(1H,3H)-dione
CAS:1-((2R,4S,5R)-5-((Bis(4-methoxyphenyl)(phenyl)methoxy)methyl)-4-hydroxytetrahydrofuran-2-yl)-5-iodopyrimidine-2,4(1H,3H)-dioneFormula:C30H29IN2O7Purity:97%Molecular weight:656.475'-O-DMTr-5-Iodo-2'-deoxyuridine
CAS:5'-O-DMTr-5-Iodo-2'-deoxyuridine is a Halo-nucleoside.Formula:C30H29IN2O7Color and Shape:SolidMolecular weight:656.46Ref: TM-TNU0647
5mgTo inquire10mgTo inquire25mgTo inquire50mgTo inquire100mgTo inquire500mgTo inquire2'-Deoxy-5'-O-DMT-5-iodouridine
CAS:2'-Deoxy-5'-O-DMT-5-iodouridine is an intercalating agent that binds to DNA and RNA. It can be used as a probe for the detection of specific sequences in human cells. The fluorophore attached to the molecule allows it to be detected by fluorescence microscopy, while the chromophore is responsible for its ability to emit light at a wavelength of 535 nm. 2'-Deoxy-5'-O-DMT-5-iodouridine has been shown to enhance nucleotide excision repair and increase the sensitivity of cancer cells to chemotherapy drugs such as cisplatin. The molecule can also be used as a fluorescent protein marker in her-2 gene amplification and overexpression studies.Formula:C30H29IN2O7Purity:Min. 95%Color and Shape:PowderMolecular weight:656.48 g/mol5’-O-DMTr-5-iodo-2’-deoxyuridine
CAS:1-((2R,4S,5R)-5-((Bis(4-methoxyphenyl)(phenyl)methoxy)methyl)-4-hydroxytetrahydrofuran-2-yl)-5-iodopyrimidine-2,4(1H,3H)-dioneFormula:C30H29IN2O7Purity:97%Molecular weight:656.46





