CAS 1043868-97-8
:2-(4-Iodo-2,5-dimethoxyphenyl)-N-(2-methoxybenzyl)ethanamine hydrochloride (1:1)
Description:
2-(4-Iodo-2,5-dimethoxyphenyl)-N-(2-methoxybenzyl)ethanamine hydrochloride is a chemical compound characterized by its complex structure, which includes a phenyl ring substituted with iodine and methoxy groups, as well as an ethanamine backbone. This compound is typically classified as a substituted phenethylamine, which may exhibit psychoactive properties due to its structural similarities to other compounds in this class. The presence of the hydrochloride salt form indicates that it is a stable, water-soluble derivative, enhancing its bioavailability for potential pharmacological applications. The methoxy groups contribute to the compound's lipophilicity, potentially influencing its interaction with biological membranes and receptors. Additionally, the iodine substitution may affect the compound's electronic properties and reactivity. As with many compounds in this category, its safety profile, therapeutic potential, and specific biological activities would require thorough investigation through empirical studies. Overall, this compound represents a unique entity within the realm of organic chemistry and pharmacology, warranting further exploration for its potential uses.
Formula:C18H23ClINO3
InChI:InChI=1S/C18H22INO3.ClH/c1-21-16-7-5-4-6-14(16)12-20-9-8-13-10-18(23-3)15(19)11-17(13)22-2;/h4-7,10-11,20H,8-9,12H2,1-3H3;1H
SMILES:COc1ccccc1CNCCc1cc(c(cc1OC)I)OC.Cl
Synonyms:- N-(2-Methoxybenzyl)-2-(2,5-dimethoxy-4-iodophenyl)ethanamine HCl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
N-(2-Methoxybenzyl)-2-(2,5-dimethoxy-4-iodophenyl)ethanamine Hydrochloride
CAS:Controlled ProductFormula:C18H22INO3·ClHColor and Shape:NeatMolecular weight:463.74

