CAS 10444-89-0
:5-(Trifluoromethyl)-1,3,4-thiadiazol-2-amine
Description:
5-(Trifluoromethyl)-1,3,4-thiadiazol-2-amine is a heterocyclic compound characterized by the presence of a thiadiazole ring, which consists of two nitrogen atoms and one sulfur atom within a five-membered ring structure. The trifluoromethyl group (-CF3) attached to the carbon adjacent to the amine group significantly influences its chemical properties, enhancing its lipophilicity and potentially its biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. Its unique structure allows it to participate in various chemical reactions, making it of interest in fields such as pharmaceuticals and agrochemicals. The presence of the amine group suggests potential for hydrogen bonding, which can affect its reactivity and interactions with other molecules. Additionally, the trifluoromethyl group can impart unique electronic properties, making this compound a subject of study for its potential applications in medicinal chemistry and material science. Safety and handling precautions should be observed due to the presence of fluorine, which can pose health risks.
Formula:C3H2F3N3S
InChI:InChI=1S/C3H2F3N3S/c4-3(5,6)1-8-9-2(7)10-1/h(H2,7,9)
InChI key:InChIKey=LTEUXHSAYOSFGQ-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1SC(N)=NN1
Synonyms:- (5-Trifluoromethyl-1,3,4-thiadiazol-2-yl)amine
- 1,3,4-Thiadiazol-2-amine, 5-(trifluoromethyl)-
- 1,3,4-Thiadiazole, 2-amino-5-(trifluoromethyl)-
- 2-Amino-5-[4-(trifluoromethyl)]-1,3,4-thiadiazole
- 2-Amino-5-trifluoromethyl-1,2,4-thiadizole
- 2-Trifluoromethyl-5-amino-1,3,4-thiadiazole
- 5-(Trifluoromethyl)-1,3,4-thiadiazol-2-amine
- 5-(Trifluoromethyl)-1,3,4-thiadiazole-2-amine
- 5-(trifluoromethyl)-4H-1,2,4-triazol-3-amine
- 5-Amino-2-(trifluoromethyl)-1,3,4-thiadiazole
- 5-Trifluoromethyl-2-amino-1,3,4-thiadiazole
- NSC 231655
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
2-Amino-5-trifluoromethyl-1,3,4-thiadiazole, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C3H2F3N3SPurity:98%Color and Shape:White to pale cream, Crystals or powder or crystalline powderMolecular weight:169.132-Amino-5-trifluoromethyl-1,3,4-thiadiazole
CAS:2-Amino-5-trifluoromethyl-1,3,4-thiadiazoleFormula:C3H2F3N3SPurity:97%Molecular weight:169.132-Amino-5-(trifluoromethyl)-1,3,4-thiadiazole
CAS:2-Amino-5-(trifluoromethyl)-1,3,4-thiadiazoleFormula:C3H2F3N3SPurity:98%Color and Shape:Off-white Solid-PowderMolecular weight:169.128285-(Trifluoromethyl)-1,3,4-thiadiazol-2-amine
CAS:Formula:C3H2F3N3SPurity:96%Color and Shape:SolidMolecular weight:169.12832-Amino-5-trifluoromethyl-1,3,4-thiadiazole
CAS:Formula:C3H2F3N3SPurity:>98.0%(HPLC)Color and Shape:White to Almost white powder to crystalMolecular weight:169.132-Amino-5-(trifluoromethyl)-1,3,4-thiadiazole
CAS:Formula:C3H2F3N3SPurity:97%Color and Shape:SolidMolecular weight:169.13





