CymitQuimica logo

CAS 1044769-69-8

:

4-[(3-Hydroxy-1-piperidinyl)methyl]benzonitrile

Description:
4-[(3-Hydroxy-1-piperidinyl)methyl]benzonitrile, identified by its CAS number 1044769-69-8, is a chemical compound characterized by its structural features that include a benzonitrile moiety and a piperidine ring with a hydroxyl group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential biological activity. The presence of the hydroxyl group suggests it may engage in hydrogen bonding, influencing its solubility and reactivity. The piperidine ring can impart basicity, which may affect its interaction with biological targets. Additionally, the nitrile group can participate in various chemical reactions, making this compound of interest in medicinal chemistry and drug development. Its specific characteristics, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the environment in which it is studied. Overall, this compound's unique structure positions it as a candidate for further research in pharmacology and organic synthesis.
Formula:C13H16N2O
InChI:InChI=1S/C13H16N2O/c14-8-11-3-5-12(6-4-11)9-15-7-1-2-13(16)10-15/h3-6,13,16H,1-2,7,9-10H2
InChI key:InChIKey=UFYYUGVJLHTOFJ-UHFFFAOYSA-N
SMILES:C(C1=CC=C(C#N)C=C1)N2CC(O)CCC2
Synonyms:
  • Benzonitrile, 4-[(3-hydroxy-1-piperidinyl)methyl]-
  • 4-[(3-Hydroxy-1-piperidinyl)methyl]benzonitrile
Found 2 products.