CymitQuimica logo

CAS 104504-38-3

:

ethyl N-acetyl-alpha-cyano-4-(phenylcarbonyl)phenylalaninate

Description:
Ethyl N-acetyl-alpha-cyano-4-(phenylcarbonyl)phenylalaninate, identified by its CAS number 104504-38-3, is a synthetic organic compound that belongs to the class of amino acid derivatives. This substance features a complex structure characterized by the presence of an ethyl ester group, an acetyl group, and a cyano group, which contribute to its chemical reactivity and potential biological activity. The phenylcarbonyl moiety enhances its lipophilicity, making it more soluble in organic solvents. The compound may exhibit various pharmacological properties, which can be attributed to its structural components, including potential anti-inflammatory or analgesic effects. Its synthesis typically involves multi-step organic reactions, and it may be used in research settings to explore its interactions with biological targets or as a precursor in the development of more complex molecules. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.
Formula:C21H20N2O4
InChI:InChI=1/C21H20N2O4/c1-3-27-20(26)21(14-22,23-15(2)24)13-16-9-11-18(12-10-16)19(25)17-7-5-4-6-8-17/h4-12H,3,13H2,1-2H3,(H,23,24)
SMILES:CCOC(=O)C(Cc1ccc(cc1)C(=O)c1ccccc1)(C#N)N=C(C)O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.