CymitQuimica logo

CAS 104540-42-3

:

2-bromo-3-fluorobenzotrifluoride

Description:
2-Bromo-3-fluorobenzotrifluoride, with the CAS number 104540-42-3, is an aromatic halogenated compound characterized by the presence of both bromine and fluorine substituents on a benzene ring that is also substituted with three trifluoromethyl groups. This compound typically exhibits a high degree of stability due to the strength of the carbon-fluorine bonds and the electron-withdrawing nature of the trifluoromethyl groups, which can influence its reactivity and solubility. It is generally a colorless to pale yellow liquid or solid, depending on the temperature and purity. The presence of multiple electronegative halogens can lead to unique electronic properties, making it of interest in various chemical applications, including as an intermediate in organic synthesis and in the development of pharmaceuticals. Additionally, its halogenated nature may impart specific characteristics such as increased lipophilicity and potential environmental persistence, which are important considerations in its handling and application. Safety data sheets should be consulted for information on toxicity and handling precautions.
Formula:C7H3BrF4
InChI:InChI=1/C7H3BrF4/c8-6-4(7(10,11)12)2-1-3-5(6)9/h1-3H
InChI key:UERAGXKMOXUWPC-UHFFFAOYSA-N
SMILES:c1cc(c(c(c1)F)Br)C(F)(F)F
Synonyms:
  • 2-Bromo-1-fluoro-3-(trifluoromethyl)benzene~2-Fluoro-6-(trifluoromethyl)bromobenzene
  • 2-Bromo-1-Fluoro-3-(Trifluoromethyl)Benzene
Found 5 products.