CAS 10457-56-4
:4-[(4-chlorophenyl)(phenyl)methyl]-1-methylpiperazine 1-oxide
Description:
4-[(4-chlorophenyl)(phenyl)methyl]-1-methylpiperazine 1-oxide, with CAS number 10457-56-4, is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. This compound features a 1-methyl substitution on the piperazine ring, enhancing its lipophilicity and potentially influencing its biological activity. The presence of a 4-chlorophenyl and a phenyl group attached to the piperazine structure suggests that it may exhibit significant interactions with biological targets, making it of interest in medicinal chemistry. The 1-oxide functional group indicates the presence of an oxygen atom bonded to one of the nitrogen atoms, which can affect the compound's reactivity and solubility. Overall, this compound may possess properties relevant to pharmacology, including potential therapeutic effects, but specific biological activities would require further investigation through experimental studies. Its structural features suggest it could be a candidate for research in areas such as neuropharmacology or as a potential drug scaffold.
Formula:C18H21ClN2O
InChI:InChI=1/C18H21ClN2O/c1-21(22)13-11-20(12-14-21)18(15-5-3-2-4-6-15)16-7-9-17(19)10-8-16/h2-10,18H,11-14H2,1H3
SMILES:CN1(=O)CCN(CC1)C(c1ccccc1)c1ccc(cc1)Cl
Synonyms:- 1-(p-Chloro-alpha-phenylbenzyl)-4-methylpiperazine 4-oxide
- Piperazine, 1-(p-chloro-alpha-phenylbenzyl)-4-methyl-, 4-oxide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.

