CymitQuimica logo

CAS 1046461-90-8

:

3-(1,3-Benzodioxol-5-yl)-1H-pyrazole-4-carboxaldehyde

Description:
3-(1,3-Benzodioxol-5-yl)-1H-pyrazole-4-carboxaldehyde, with the CAS number 1046461-90-8, is a chemical compound characterized by its unique structural features, which include a pyrazole ring and a benzodioxole moiety. This compound typically exhibits properties associated with both heterocyclic and aromatic compounds, such as potential reactivity due to the presence of the aldehyde functional group. The benzodioxole portion contributes to its aromatic character and may influence its solubility and interaction with biological systems. It is often studied for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with various biological targets. The compound may also exhibit fluorescence properties, making it useful in analytical chemistry. Additionally, its synthesis involves multi-step organic reactions, which can include condensation and cyclization processes. Overall, this compound represents a class of heterocyclic compounds that are of interest for their diverse chemical reactivity and potential therapeutic applications.
Formula:C11H8N2O3
InChI:InChI=1S/C11H8N2O3/c14-5-8-4-12-13-11(8)7-1-2-9-10(3-7)16-6-15-9/h1-5H,6H2,(H,12,13)
InChI key:InChIKey=KNGSJLHOXNAMTI-UHFFFAOYSA-N
SMILES:C(=O)C=1C(C=2C=C3C(=CC2)OCO3)=NNC1
Synonyms:
  • 1H-Pyrazole-4-carboxaldehyde, 3-(1,3-benzodioxol-5-yl)-
  • 3-(1,3-Benzodioxol-5-yl)-1H-pyrazole-4-carboxaldehyde
Found 1 products.