CymitQuimica logo

CAS 10465-91-5

:

3-(4-chlorophenyl)chromen-2-one

Description:
3-(4-Chlorophenyl)chromen-2-one, also known as 4-chloroflavanone, is a chemical compound characterized by its chromenone structure, which consists of a chromene ring fused with a carbonyl group. This compound features a 4-chlorophenyl substituent at the 3-position of the chromenone, contributing to its unique properties. It typically appears as a solid or crystalline substance and is known for its potential biological activities, including antioxidant and anti-inflammatory effects. The presence of the chlorophenyl group can influence its reactivity and solubility in various solvents. In terms of applications, compounds like 3-(4-chlorophenyl)chromen-2-one are often studied for their pharmacological properties and may serve as intermediates in organic synthesis or as potential therapeutic agents. Its molecular structure allows for various chemical modifications, making it a subject of interest in medicinal chemistry and drug development. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C15H9ClO2
InChI:InChI=1/C15H9ClO2/c16-12-7-5-10(6-8-12)13-9-11-3-1-2-4-14(11)18-15(13)17/h1-9H
SMILES:c1ccc2c(c1)cc(c1ccc(cc1)Cl)c(=O)o2
Synonyms:
  • 10465-91-5
  • 3-(4-Chlorophenyl)-2H-1-benzopyran-2-one
  • 3-(4-Chlorophenyl)-2H-chromen-2-one
  • 3-(4-Chlorophenyl)coumarin
  • 3-(p-Chlorophenyl)coumarin
Found 1 products.