CAS 10466-75-8
:DNP-γ-aminobutyric acid
Description:
DNP-γ-aminobutyric acid, also known as 4-amino-3-hydroxybutanoic acid, is an organic compound characterized by its amino and hydroxyl functional groups. It is a derivative of γ-aminobutyric acid (GABA), which is a significant neurotransmitter in the central nervous system. The presence of the dinitrophenyl (DNP) group in its structure enhances its reactivity and potential applications in biochemical research. This compound is typically a white to yellow crystalline solid, soluble in water and polar organic solvents, which facilitates its use in various chemical reactions and biological studies. DNP-γ-aminobutyric acid is often utilized in the synthesis of other chemical entities and may serve as a tool in neuropharmacological research due to its structural similarity to GABA. Its properties, such as melting point, boiling point, and specific reactivity, can vary based on environmental conditions and the presence of other substances. As with many chemical compounds, safety precautions should be observed when handling DNP-γ-aminobutyric acid due to its potential biological activity.
Formula:C10H11N3O6
InChI:InChI=1S/C10H11N3O6/c14-10(15)2-1-5-11-8-4-3-7(12(16)17)6-9(8)13(18)19/h3-4,6,11H,1-2,5H2,(H,14,15)
InChI key:InChIKey=VZQBXLQRVMDXRH-UHFFFAOYSA-N
SMILES:N(CCCC(O)=O)C1=C(N(=O)=O)C=C(N(=O)=O)C=C1
Synonyms:- 2,4-Dnp-GABA
- 4-[(2,4-Dinitrophenyl)Amino]Butanoic Acid
- Butanoic acid, 4-((2,4-dintrophenyl)amino)-, (3R-(3alpha,3aalpha,4beta,4abeta,7abeta,8alpha,9abeta))-
- Butanoic acid, 4-[(2,4-dinitrophenyl)amino]-
- Butyric acid, 4-(2,4-dinitroanilino)-
- DNP-γ-aminobutyric acid
- N-(2,4-Dinitrophenyl)-4-aminobutyric acid
- N-(2,4-Dinitrophenyl)-gamma-aminobutyric acid
- Nsc 89612
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-((2,4-Dinitrophenyl)amino)butanoic acid
CAS:4-((2,4-Dinitrophenyl)amino)butanoic acidFormula:C10H11N3O6Purity:97%Molecular weight:269.21Dnp-γ-Amino-N-Butyric Acid
CAS:Formula:C10H11N3O6Purity:95%Color and Shape:SolidMolecular weight:269.21084-[(2,4-Dinitrophenyl)amino]butanoic acid
CAS:4-[(2,4-Dinitrophenyl)amino]butanoic acid (4DNPA) is an acceptor for elongating ribosomes and is involved in the covalent binding of peptidyl tRNA to aminoacyl tRNA synthetase. 4DNPA has been shown to be reactive with the subunit of bacterial ribosomes and form covalent complexes. It also reacts with peptidyl-tRNA, forming a covalent adduct. This adduct blocks the peptidyl site on the ribosome and prevents protein synthesis.
Formula:C10H11N3O6Purity:Min. 95%Molecular weight:269.21 g/mol




