CAS 104669-02-5
:(1S)-1,5-anhydro-1-[2,4,6-trihydroxy-3-(4-hydroxybenzoyl)phenyl]-D-glucitol
Description:
(1S)-1,5-Anhydro-1-[2,4,6-trihydroxy-3-(4-hydroxybenzoyl)phenyl]-D-glucitol, with CAS number 104669-02-5, is a complex organic compound characterized by its structural features that include a glucitol backbone and multiple hydroxyl groups. This compound exhibits significant solubility in polar solvents due to its numerous hydroxyl groups, which can engage in hydrogen bonding. The presence of the phenolic moiety, specifically the 4-hydroxybenzoyl group, contributes to its potential antioxidant properties, making it of interest in various biochemical applications. Its stereochemistry, indicated by the (1S) configuration, suggests specific spatial arrangements that may influence its biological activity and interaction with other molecules. Additionally, the compound's anhydro form indicates the absence of water in its structure, which can affect its stability and reactivity. Overall, this substance may have applications in pharmaceuticals, food science, or as a biochemical probe, although specific uses would depend on further research into its properties and interactions.
Formula:C19H20O10
InChI:InChI=1/C19H20O10/c20-6-11-15(25)17(27)18(28)19(29-11)13-10(23)5-9(22)12(16(13)26)14(24)7-1-3-8(21)4-2-7/h1-5,11,15,17-23,25-28H,6H2/t11-,15-,17+,18-,19+/m1/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Iriflophene 3-C-β-D-glucopyraside
CAS:Formula:C19H20O10Purity:98%Color and Shape:SolidMolecular weight:408.3561Iriflophenone 3-C-glucoside
CAS:Formula:C19H20O10Purity:95%~99%Color and Shape:PowderMolecular weight:408.359Iriflophenone 3-C-glucoside
CAS:Iriflophenone 3-C-glucoside (Iriflophenone 3-C-β-D-glucopyranoside),has antioxidant activity,isolated from Cyclopia genistoides.Formula:C19H20O10Purity:98.87%Color and Shape:SolidMolecular weight:408.36Iriflophenone 3-c-glucoside
CAS:Natural glycosideFormula:C19H20O10Purity:≥ 90.0 % (HPLC)Color and Shape:PowderMolecular weight:408.36Iriflophenone 3-C-b-D-glucopyranoside
CAS:Iriflophenone 3-C-β-D-glucopyranoside is a glucoside compound, which is a naturally occurring chemical constituent often found in certain plant species. It is typically isolated from members of the genus *Garcinia*, a group of flowering plants known for their diverse secondary metabolites. The mode of action of Iriflophenone 3-C-β-D-glucopyranoside involves its role as an antioxidant, potentially offering protection against oxidative stress by scavenging free radicals. This compound may also exhibit other bioactivities such as anti-inflammatory or anti-microbial effects, although these require further elucidation through research.Formula:C19H20O10Purity:Min. 98 Area-%Color and Shape:White PowderMolecular weight:408.36 g/molIriflophenone 3-C-b-D-Glucopyranoside
CAS:Controlled ProductFormula:C19H20O10Color and Shape:NeatMolecular weight:408.356







