CAS 104670-74-8
:Benzoic acid, 2-amino-3-bromo-, methyl ester
Description:
Benzoic acid, 2-amino-3-bromo-, methyl ester, also known by its CAS number 104670-74-8, is an organic compound characterized by the presence of a benzoic acid moiety with an amino group and a bromo substituent at specific positions on the aromatic ring. This compound typically appears as a white to off-white solid and is soluble in organic solvents such as ethanol and acetone, but has limited solubility in water due to its hydrophobic aromatic structure. The presence of the amino group introduces basic properties, while the bromo substituent can influence its reactivity and potential applications in organic synthesis. This compound may be utilized in various chemical reactions, including nucleophilic substitutions and coupling reactions, making it valuable in the synthesis of pharmaceuticals and agrochemicals. Its unique structural features contribute to its potential biological activity, which may warrant further investigation in medicinal chemistry. As with many organic compounds, appropriate safety measures should be taken when handling this substance due to potential toxicity and reactivity.
Formula:C8H8BrNO2
InChI:InChI=1S/C8H8BrNO2/c1-12-8(11)5-3-2-4-6(9)7(5)10/h2-4H,10H2,1H3
SMILES:COC(=O)c1cccc(c1N)Br
Synonyms:- Methyl 2-Amino-3-Bromobenzoate
- 2-amino-3-bromo-Benzoic acid methyl ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Methyl 2-amino-3-bromobenzoate
CAS:Methyl 2-amino-3-bromobenzoateFormula:C8H8BrNO2Purity:98%Molecular weight:230.06Methyl 2-amino-3-bromobenzoate
CAS:Methyl 2-amino-3-bromobenzoateFormula:C8H8BrNO2Purity:97%Color and Shape:SolidMolecular weight:230.05862Methyl 2-amino-3-bromobenzoate
CAS:Methyl 2-amino-3-bromobenzoate is a high quality, versatile building block that is used as a reagent and intermediate in the synthesis of biologically active compounds. Methyl 2-amino-3-bromobenzoate is a complex compound that has proven useful as an intermediate in the synthesis of various fine chemicals, such as speciality chemicals. The compound also serves as a useful scaffold for the preparation of other compounds, such as research chemicals. Methyl 2-amino-3-bromobenzoate can be used in reactions with other reagents to form new compounds. It is also used to make important reaction components, such as CAS No. 104670-74-8.
Formula:C8H8BrNO2Purity:Min. 95%Color and Shape:PowderMolecular weight:230.06 g/molMethyl 2-amino-3-bromobenzoate
CAS:Formula:C8H8BrNO2Purity:97%Color and Shape:SolidMolecular weight:230.0612-Amino-3-bromobenzoic acid methyl ester
CAS:Formula:C8H8BrNO2Purity:98%Color and Shape:SolidMolecular weight:230.0586




