CymitQuimica logo

CAS 1046757-32-7

:

Acetamide, 2-amino-N-(2-bromophenyl)-, hydrochloride (1:1)

Description:
Acetamide, 2-amino-N-(2-bromophenyl)-, hydrochloride (1:1) is a chemical compound characterized by its amide functional group, which is derived from acetic acid. This compound features a bromophenyl moiety, indicating the presence of a bromine atom attached to a phenyl ring, specifically at the 2-position. The hydrochloride form suggests that the compound is a salt formed with hydrochloric acid, enhancing its solubility in water and making it more stable for storage and handling. The presence of the amino group indicates potential basic properties, allowing for interactions with acids and other electrophiles. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure contributes to its reactivity and potential applications in organic synthesis or medicinal chemistry. As with many halogenated compounds, it may also display unique properties such as altered lipophilicity and reactivity compared to its non-brominated counterparts. Safety data should be consulted for handling and usage, as halogenated compounds can pose environmental and health risks.
Formula:C8H9BrN2O·ClH
InChI:InChI=1S/C8H9BrN2O.ClH/c9-6-3-1-2-4-7(6)11-8(12)5-10;/h1-4H,5,10H2,(H,11,12);1H
InChI key:InChIKey=NPEURHXBRMMWPU-UHFFFAOYSA-N
SMILES:N(C(CN)=O)C1=C(Br)C=CC=C1.Cl
Synonyms:
  • Acetamide, 2-amino-N-(2-bromophenyl)-, hydrochloride (1:1)
Found 3 products.