CymitQuimica logo

CAS 104685-76-9

:

3-Pyridinecarboxylic acid, 5,6-diamino-, methyl ester

Description:
3-Pyridinecarboxylic acid, 5,6-diamino-, methyl ester, also known as methyl 5,6-diaminonicotinate, is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a carboxylic acid functional group that has been esterified with methanol, resulting in a methyl ester. The presence of two amino groups at the 5 and 6 positions of the pyridine ring contributes to its potential as a building block in pharmaceuticals and agrochemicals. The compound is typically a white to off-white solid and is soluble in polar solvents, which enhances its reactivity and utility in various chemical reactions. Its biological activity may include roles in metabolic pathways or as a precursor for the synthesis of more complex molecules. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper laboratory practices are followed.
Formula:C7H9N3O2
InChI:InChI=1S/C7H9N3O2/c1-12-7(11)4-2-5(8)6(9)10-3-4/h2-3H,8H2,1H3,(H2,9,10)
InChI key:KZFTZZIOEVUOOT-UHFFFAOYSA-N
SMILES:COC(=O)C1=CC(=C(N=C1)N)N
Found 7 products.