CAS 104685-82-7

2-chloro-1H-imidazo[4,5-b]pyridine hydrochloride

Description:

2-Chloro-1H-imidazo[4,5-b]pyridine hydrochloride is a chemical compound characterized by its imidazo-pyridine structure, which features a fused ring system containing both nitrogen and carbon atoms. This compound is typically a white to off-white crystalline solid, soluble in water and various organic solvents, which makes it useful in pharmaceutical applications. The presence of the chlorine atom at the 2-position of the imidazo ring contributes to its reactivity and potential biological activity. As a hydrochloride salt, it is often more stable and easier to handle than its free base form. This compound has garnered interest in medicinal chemistry due to its potential as a pharmacological agent, particularly in the development of drugs targeting specific biological pathways. Its unique structural features allow for interactions with various biological targets, making it a subject of research in areas such as cancer therapy and other therapeutic applications. Safety data should be consulted for handling and usage, as with all chemical substances.

Formula: C₆H₅Cl₂N₃

InChI: InChI=1/C6H4ClN3.ClH/c7-6-9-4-2-1-3-8-5(4)10-6;/h1-3H,(H,8,9,10);1H

SMILES: c1cc2c(nc1)[nH]c(Cl)n2.Cl

2-Chloro-1H-imidazo[4,5-b]pyridine

CAS: 104685-82-7

Formula: C₆H₄ClN₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 153.5691

Ref: IN-DA007XP5

2-Chloro-1H-imidazo[4,5-b]pyridine

CAS: 104685-82-7

2-Chloro-1H-imidazo[4,5-b]pyridine is a sulfonylating agent that reacts with hydantoins to produce 2-chloro-1H-imidazo[4,5b]pyridines. The reaction is catalyzed by acetonitrile and chlorination in the presence of ammonium chloride. The reaction can be carried out in acidic or basic conditions. This process leads to alkylation of the nitrogen atom and formation of a chiral product. It takes about 12 hours for the reaction to complete. It is not known if there are any age restrictions for this product.

Formula: C₆H₄ClN₃

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 153.57 g/mol

Ref: 3D-FC141721

2-Chloro-1H-imidazo[4,5-b]pyridine

CAS: 104685-82-7

Formula: C₆H₄ClN₃

Purity: 95%;RG

Color and Shape: Solid, Yellow powder

Molecular weight: 153.57

Ref: 10-F227829