CAS 104685-82-7
:2-chloro-1H-imidazo[4,5-b]pyridine hydrochloride
Description:
2-Chloro-1H-imidazo[4,5-b]pyridine hydrochloride is a chemical compound characterized by its imidazo-pyridine structure, which features a fused ring system containing both nitrogen and carbon atoms. This compound is typically a white to off-white crystalline solid, soluble in water and various organic solvents, which makes it useful in pharmaceutical applications. The presence of the chlorine atom at the 2-position of the imidazo ring contributes to its reactivity and potential biological activity. As a hydrochloride salt, it is often more stable and easier to handle than its free base form. This compound has garnered interest in medicinal chemistry due to its potential as a pharmacological agent, particularly in the development of drugs targeting specific biological pathways. Its unique structural features allow for interactions with various biological targets, making it a subject of research in areas such as cancer therapy and other therapeutic applications. Safety data should be consulted for handling and usage, as with all chemical substances.
Formula:C6H5Cl2N3
InChI:InChI=1/C6H4ClN3.ClH/c7-6-9-4-2-1-3-8-5(4)10-6;/h1-3H,(H,8,9,10);1H
SMILES:c1cc2c(nc1)[nH]c(Cl)n2.Cl
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Chloro-1H-Imidazo[4,5-B]Pyridine
CAS:2-Chloro-1H-Imidazo[4,5-B]PyridineFormula:C6H4ClN3Purity:97%Molecular weight:153.572-Chloro-1H-imidazo[4,5-b]pyridine
CAS:Formula:C6H4ClN3Purity:95%Color and Shape:SolidMolecular weight:153.56912-Chloro-1H-imidazo[4,5-b]pyridine
CAS:2-Chloro-1H-imidazo[4,5-b]pyridine is a sulfonylating agent that reacts with hydantoins to produce 2-chloro-1H-imidazo[4,5b]pyridines. The reaction is catalyzed by acetonitrile and chlorination in the presence of ammonium chloride. The reaction can be carried out in acidic or basic conditions. This process leads to alkylation of the nitrogen atom and formation of a chiral product. It takes about 12 hours for the reaction to complete. It is not known if there are any age restrictions for this product.Formula:C6H4ClN3Purity:Min. 95%Color and Shape:PowderMolecular weight:153.57 g/mol2-Chloro-1H-imidazo[4,5-b]pyridine
CAS:Formula:C6H4ClN3Purity:95%;RGColor and Shape:Solid, Yellow powderMolecular weight:153.57




