CymitQuimica logo

CAS 1046864-84-9

:

2,5-Bis(1,1-dimethylethyl) 3,6-bis(5-bromo-2-thienyl)-1,4-dioxopyrrolo[3,4-c]pyrrole-2,5(1H,4H)-dicarboxylate

Description:
2,5-Bis(1,1-dimethylethyl) 3,6-bis(5-bromo-2-thienyl)-1,4-dioxopyrrolo[3,4-c]pyrrole-2,5(1H,4H)-dicarboxylate is a complex organic compound characterized by its unique structural features, including a pyrrolo[3,4-c]pyrrole core, which contributes to its potential applications in organic electronics and dye-sensitized solar cells. The presence of multiple functional groups, such as dicarboxylate and thienyl moieties, enhances its reactivity and solubility in various solvents. The bromine substituents introduce additional electronic properties, potentially affecting the compound's optical characteristics. This substance is likely to exhibit interesting photophysical properties, making it a candidate for research in materials science and organic synthesis. Its bulky tert-butyl groups provide steric hindrance, which can influence its aggregation behavior and stability in different environments. Overall, this compound's intricate structure and functional diversity suggest potential utility in advanced materials and organic semiconductor applications.
Formula:C24H22Br2N2O6S2
InChI:InChI=1S/C24H22Br2N2O6S2/c1-23(2,3)33-21(31)27-17(11-7-9-13(25)35-11)15-16(19(27)29)18(12-8-10-14(26)36-12)28(20(15)30)22(32)34-24(4,5)6/h7-10H,1-6H3
InChI key:InChIKey=QOZQIPYHXMJDFH-UHFFFAOYSA-N
SMILES:O=C1C=2C(=C(N1C(OC(C)(C)C)=O)C=3SC(Br)=CC3)C(=O)N(C(OC(C)(C)C)=O)C2C=4SC(Br)=CC4
Synonyms:
  • 2,5-Bis(1,1-dimethylethyl) 3,6-bis(5-bromo-2-thienyl)-1,4-dioxopyrrolo[3,4-c]pyrrole-2,5(1H,4H)-dicarboxylate
  • Pyrrolo[3,4-c]pyrrole-2,5(1H,4H)-dicarboxylic acid, 3,6-bis(5-bromo-2-thienyl)-1,4-dioxo-, 2,5-bis(1,1-dimethylethyl) ester
Found 4 products.