CAS 10470-82-3
:2-(2-Naphthyloxy)propionic acid
Description:
2-(2-Naphthyloxy)propionic acid, with the CAS number 10470-82-3, is an organic compound characterized by its naphthalene-derived structure, which contributes to its aromatic properties. This compound features a propionic acid moiety, indicating the presence of a carboxylic acid functional group, which imparts acidic characteristics. The naphthyl group enhances its hydrophobicity, influencing its solubility in organic solvents while potentially limiting its solubility in water. This substance is often studied for its biological activity, particularly in the context of its role as a herbicide or plant growth regulator, due to its ability to interact with specific biochemical pathways in plants. Additionally, its structural features may allow for various chemical modifications, making it a candidate for further research in medicinal chemistry and agrochemicals. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C13H12O3
InChI:InChI=1S/C13H12O3/c1-9(13(14)15)16-12-7-6-10-4-2-3-5-11(10)8-12/h2-9H,1H3,(H,14,15)
InChI key:InChIKey=HMIVVAPMRQMNAK-UHFFFAOYSA-N
SMILES:O(C(C(O)=O)C)C1=CC2=C(C=C1)C=CC=C2
Synonyms:- 2-(2-Naphthalenyloxy)propanoic acid
- 2-(2-Naphthyloxy)propanoic acid
- 2-(2-Naphthyloxy)propionic acid
- 2-(Naphthalen-2-yloxy)propionic acid
- Propanoic Acid, 2-(2-Naphthalenyloxy)-
- Propionic acid, 2-(2-naphthyloxy)-
- α-(2-Naphthoxy)propionic acid
- α-(2-Naphthyloxy)propionic acid
- α-(β-Naphthoxy)propionic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-(Naphthalen-2-yloxy)propanoic acid
CAS:2-(Naphthalen-2-yloxy)propanoic acidFormula:C13H12O3Purity:95+%Molecular weight:216.242-(Naphthalen-2-yloxy)propanoic acid
CAS:2-(Naphthalen-2-yloxy)propanoic acidFormula:C13H12O3Purity:95+%Molecular weight:216.232-(2-Naphthyloxy)propanoic acid
CAS:2-(2-Naphthyloxy)propanoic acid is a naphthalene derivative that is found in the plant species Carthamus tinctorius. It has been shown to have potent antagonist activity against the NMDA receptor, as well as antinociceptive and analgesic properties in vivo. 2-(2-Naphthyloxy)propanoic acid also shows potent anti-inflammatory and cardioprotective effects in vitro and in vivo. 2-(2-Naphthyloxy)propanoic acid can be used for the treatment of bone cancer, congestive heart failure, diabetic neuropathy, or other disorders of the peripheral nervous system.
Formula:C13H12O3Purity:Min. 95%Molecular weight:216.23 g/mol2-(2-Naphthyloxy)-propionic acid
CAS:Controlled ProductFormula:C13H12O3Color and Shape:NeatMolecular weight:216.23





