CAS 104700-97-2
:Ganodermenonol
Description:
Ganodermenonol, with the CAS number 104700-97-2, is a chemical compound derived from certain species of fungi, particularly those in the Ganoderma genus, which are known for their medicinal properties. This compound is characterized by its triterpenoid structure, which contributes to its bioactive properties. Ganodermenonol exhibits various pharmacological activities, including anti-inflammatory, antioxidant, and potential anticancer effects, making it of interest in both traditional medicine and modern pharmacology. Its solubility and stability can vary depending on the solvent and environmental conditions, which is important for its application in formulations. Additionally, research into Ganodermenonol's mechanisms of action and therapeutic potential is ongoing, highlighting its significance in the field of natural products and drug discovery. As with many bioactive compounds, the safety profile and potential side effects are also subjects of investigation, ensuring that its use in health applications is both effective and safe.
Formula:C30H46O2
InChI:InChI=1/C30H46O2/c1-20(19-31)9-8-10-21(2)22-13-17-30(7)24-11-12-25-27(3,4)26(32)15-16-28(25,5)23(24)14-18-29(22,30)6/h9,11,14,21-22,25,31H,8,10,12-13,15-19H2,1-7H3/b20-9+/t21-,22+,25?,28-,29-,30+/m1/s1
InChI key:InChIKey=QWFPQDGDUOGOJF-SPFFTVLFSA-N
SMILES:C[C@]12C=3C([C@]4(C)[C@@](CC3)(C(C)(C)C(=O)CC4)[H])=CC[C@]1(C)[C@@]([C@@H](CC/C=C(/CO)\C)C)(CC2)[H]
Synonyms:- (+)-Ganoderol A
- (24E)-26-Hydroxylanosta-7,9(11),24-trien-3-one
- (5xi,17alpha,24E)-26-hydroxylanosta-7,9(11),24-trien-3-one
- 26-Hydroxy-lanosta-7,9(11),24-triene-3-one
- Lanosta-7,9(11),24-trien-3-one, 26-hydroxy-, (24E)-
- Ganodermenonol
- Gaderol A
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Ganoderol A
CAS:Ganoderol A offers anti-inflammatory benefits, UVA protection, and inhibits angiotensin enzyme and cholesterol synthesis.Formula:C30H46O2Purity:98%Color and Shape:SolidMolecular weight:438.69ganoderol A
CAS:Controlled ProductGanoderol A is a natural compound that inhibits the synthesis of cholesterol. It is isolated from the rhizome of Gastrodia elata, a Chinese medicinal herb. This compound binds to the enzyme HMG-CoA reductase, which catalyzes the rate-limiting step in cholesterol synthesis. Ganoderol A has been shown to inhibit cholesterol synthesis in vitro with IC50 values at 6.8 µM. It has also been found to have antimicrobial effects against Gram-positive bacteria and fungi. The chemical structure of ganoderol A is lanostane, which belongs to the class of chemical substances known as sesquiterpenoids.
Formula:C30H46O2Purity:Min. 95%Molecular weight:438.69 g/mol






