CymitQuimica logo

CAS 104703-38-0

:

N-(4-bromophenyl)-2-methoxyacetamide

Description:
N-(4-bromophenyl)-2-methoxyacetamide is an organic compound characterized by its amide functional group, which is derived from acetic acid. This compound features a bromophenyl group, indicating the presence of a bromine atom attached to a phenyl ring, which contributes to its unique chemical properties and potential reactivity. The methoxy group (-OCH3) enhances its solubility in organic solvents and can influence its biological activity. The molecular structure suggests that it may exhibit moderate polarity due to the presence of both hydrophobic (the phenyl and bromine) and hydrophilic (the methoxy and amide) components. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its potential biological activity. Additionally, its stability and reactivity can be influenced by the electronic effects of the bromine substituent and the methoxy group. As with many organic compounds, handling should be done with care, considering safety protocols and potential hazards associated with brominated compounds.
Formula:C9H10BrNO2
InChI:InChI=1/C9H10BrNO2/c1-13-6-9(12)11-8-4-2-7(10)3-5-8/h2-5H,6H2,1H3,(H,11,12)
SMILES:COCC(=O)Nc1ccc(cc1)Br
Synonyms:
  • acetamide, N-(4-bromophenyl)-2-methoxy-
Found 1 products.