CymitQuimica logo

CAS 10472-83-0

:

(3,5-dimethylphenyl)-(4-methoxyphenyl)methanone

Description:
(3,5-Dimethylphenyl)-(4-methoxyphenyl)methanone, also known by its CAS number 10472-83-0, is an organic compound characterized by its ketone functional group, specifically a methanone structure where two aromatic rings are attached. The compound features a 3,5-dimethylphenyl group, which contributes to its hydrophobic characteristics and potential for steric hindrance, and a 4-methoxyphenyl group, which introduces an electron-donating methoxy group that can influence its reactivity and solubility. This compound is typically solid at room temperature and may exhibit moderate solubility in organic solvents due to its aromatic nature. Its molecular structure suggests potential applications in organic synthesis, particularly in the development of pharmaceuticals or agrochemicals, where the unique combination of substituents can affect biological activity. Additionally, the presence of both methyl and methoxy groups can enhance its lipophilicity, making it an interesting candidate for studies in medicinal chemistry. Safety data should be consulted for handling and usage, as with all chemical substances.
Formula:C16H16O2
InChI:InChI=1/C16H16O2/c1-11-8-12(2)10-14(9-11)16(17)13-4-6-15(18-3)7-5-13/h4-10H,1-3H3
SMILES:Cc1cc(C)cc(c1)C(=O)c1ccc(cc1)OC
Found 1 products.