CymitQuimica logo

CAS 104737-00-0

:

5-bromo-2-methyl-8-nitro-1,2,3,4-tetrahydroisoquinoline

Description:
5-Bromo-2-methyl-8-nitro-1,2,3,4-tetrahydroisoquinoline is a chemical compound that belongs to the class of tetrahydroisoquinolines, which are bicyclic compounds featuring a nitrogen atom within a saturated ring structure. This specific compound is characterized by the presence of a bromine atom at the 5-position, a methyl group at the 2-position, and a nitro group at the 8-position of the isoquinoline framework. The presence of these substituents can significantly influence the compound's chemical reactivity, solubility, and biological activity. Tetrahydroisoquinolines are often studied for their potential pharmacological properties, including neuroactivity and interactions with various biological targets. The nitro group may enhance the compound's reactivity, while the bromine and methyl groups can affect its lipophilicity and overall stability. As with many organic compounds, the specific characteristics such as melting point, boiling point, and solubility would depend on the molecular structure and the interactions between its functional groups.
Formula:C10H11BrN2O2
InChI:InChI=1S/C10H11BrN2O2/c1-12-5-4-7-8(6-12)10(13(14)15)3-2-9(7)11/h2-3H,4-6H2,1H3
InChI key:DXRCGGKIRYSZQP-UHFFFAOYSA-N
SMILES:CN1CCC2=C(C=CC(=C2C1)[N+](=O)[O-])Br
Found 4 products.