CymitQuimica logo

CAS 104754-51-0

:

2-Furancarboxylicacid,tetrahydro-5-oxo-2-[[(phenylmethoxy)carbonyl]amino]-(9CI)

Description:
2-Furancarboxylic acid, tetrahydro-5-oxo-2-[(phenylmethoxy)carbonyl]amino- is a chemical compound characterized by its unique structure, which includes a furan ring and a carboxylic acid functional group. This compound features a tetrahydrofuran moiety, indicating it has a saturated cyclic structure with oxygen, contributing to its reactivity and potential applications in organic synthesis. The presence of the phenylmethoxycarbonyl group suggests that it may exhibit properties related to aromatic compounds, such as increased stability and potential for electrophilic substitution reactions. Additionally, the amino group in the structure indicates that it can participate in various chemical reactions, including amide formation and nucleophilic attacks. This compound may be of interest in pharmaceutical chemistry due to its potential biological activity and ability to serve as a building block for more complex molecules. Its specific properties, such as solubility, melting point, and reactivity, would depend on the surrounding conditions and the presence of other functional groups.
Formula:C13H13NO6
InChI:InChI=1S/C13H13NO6/c15-10-6-7-13(20-10,11(16)17)14-12(18)19-8-9-4-2-1-3-5-9/h1-5H,6-8H2,(H,14,18)(H,16,17)
InChI key:AYCUKPVNIHDFNH-UHFFFAOYSA-N
SMILES:C1CC(OC1=O)(C(=O)O)NC(=O)OCC2=CC=CC=C2
Found 2 products.