CymitQuimica logo

CAS 10476-41-2

:

4-methoxy-2,2'-bipyrrole-5-carboxaldehyde

Description:
4-Methoxy-2,2'-bipyrrole-5-carboxaldehyde is an organic compound characterized by its bipyrrole structure, which consists of two pyrrole rings connected by a carbon-carbon bond. The presence of a methoxy group (-OCH3) at the 4-position and an aldehyde group (-CHO) at the 5-position contributes to its reactivity and potential applications in organic synthesis. This compound typically exhibits properties such as solubility in organic solvents, and its functional groups can participate in various chemical reactions, including nucleophilic additions and condensation reactions. The aldehyde functionality allows for further derivatization, making it useful in the synthesis of more complex molecules. Additionally, the bipyrrole framework is of interest in the fields of materials science and medicinal chemistry due to its potential biological activity and electronic properties. As with many organic compounds, safety precautions should be taken when handling this substance, including the use of appropriate personal protective equipment and adherence to safety data sheet guidelines.
Formula:C10H10N2O2
InChI:InChI=1/C10H10N2O2/c1-14-10-5-8(12-9(10)6-13)7-3-2-4-11-7/h2-6,11-12H,1H3
InChI key:MQCYELLGZFKAFD-UHFFFAOYSA-N
SMILES:COc1cc(c2ccc[nH]2)[nH]c1C=O
Synonyms:
  • (2,2'-Bi-1H-pyrrole)-5-carboxaldehyde, 4-methoxy-
  • 4-methoxy-1H,1'H-2,2'-bipyrrole-5-carbaldehyde
  • 4-Methoxy-2,2'-bipyrrole-5-carboxaldehyde
Found 4 products.