CymitQuimica logo

CAS 1047620-84-7

:

1,6-Heptadien-4-ol, 4-(1-aminoethyl)-, hydrochloride (1:1)

Description:
1,6-Heptadien-4-ol, 4-(1-aminoethyl)-, hydrochloride (1:1) is a chemical compound characterized by its dual functional groups, featuring both an alcohol and an amine. The presence of a heptadiene structure indicates that it contains a seven-carbon chain with two double bonds, which contributes to its reactivity and potential for polymerization. The hydroxyl (-OH) group provides the compound with hydrophilic properties, while the aminoethyl group introduces basic characteristics, allowing for potential interactions with acids and other electrophiles. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form, enhancing its utility in various applications, including pharmaceuticals and organic synthesis. The compound's specific stereochemistry and the arrangement of substituents can influence its biological activity and reactivity. Overall, this compound's unique structure and functional groups make it a subject of interest in medicinal chemistry and materials science.
Formula:C9H17NO·ClH
InChI:InChI=1S/C9H17NO.ClH/c1-4-6-9(11,7-5-2)8(3)10;/h4-5,8,11H,1-2,6-7,10H2,3H3;1H
InChI key:InChIKey=MEDOFOOUSBXHJP-UHFFFAOYSA-N
SMILES:C(CC=C)(CC=C)(C(C)N)O.Cl
Synonyms:
  • 1,6-Heptadien-4-ol, 4-(1-aminoethyl)-, hydrochloride (1:1)
Found 1 products.