CymitQuimica logo

CAS 1047644-76-7

:

1,4-dimethyl-5-(tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole

Description:
1,4-Dimethyl-5-(tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole is a chemical compound characterized by its unique structure, which includes a pyrazole ring substituted with two methyl groups at the 1 and 4 positions and a tetramethyl-1,3,2-dioxaborolane moiety at the 5 position. This compound is notable for its potential applications in organic synthesis and materials science, particularly in the development of boron-containing compounds that can serve as intermediates or catalysts. The presence of the dioxaborolane group enhances its reactivity and solubility in various organic solvents, making it useful in cross-coupling reactions and other synthetic methodologies. Additionally, the pyrazole ring contributes to the compound's stability and may impart specific electronic properties, which can be advantageous in designing functional materials. Overall, this compound exemplifies the intersection of boron chemistry and heterocyclic compounds, showcasing the versatility and utility of such structures in modern chemical research.
Formula:C11H19BN2O2
InChI:InChI=1S/C11H19BN2O2/c1-8-7-13-14(6)9(8)12-15-10(2,3)11(4,5)16-12/h7H,1-6H3
InChI key:NOZSCXDKBYFTBH-UHFFFAOYSA-N
SMILES:B1(OC(C(O1)(C)C)(C)C)C2=C(C=NN2C)C
Found 4 products.