CymitQuimica logo

CAS 1047684-56-9

:

2,2'-Bipyridine, 4,4'-bis(5-hexyl-2-thienyl)-

Description:
2,2'-Bipyridine, 4,4'-bis(5-hexyl-2-thienyl)- is an organic compound characterized by its bipyridine backbone, which consists of two pyridine rings connected at the 2 and 2' positions. The presence of thienyl groups, specifically 5-hexyl-2-thienyl, introduces additional properties such as increased solubility and potential for π-π stacking interactions, which can enhance its electronic properties. This compound is likely to exhibit interesting photophysical characteristics, making it a candidate for applications in organic electronics, such as organic light-emitting diodes (OLEDs) or organic photovoltaics (OPVs). Its structure suggests potential for coordination chemistry, as bipyridine ligands are known to form stable complexes with various metal ions. The hexyl substituents on the thienyl rings can also influence the compound's solubility and stability in different solvents. Overall, this compound's unique structural features may contribute to its utility in advanced materials science and coordination chemistry.
Formula:C30H36N2S2
InChI:InChI=1S/C30H36N2S2/c1-3-5-7-9-11-25-13-15-29(33-25)23-17-19-31-27(21-23)28-22-24(18-20-32-28)30-16-14-26(34-30)12-10-8-6-4-2/h13-22H,3-12H2,1-2H3
InChI key:DCFNCZSDXIPGOQ-UHFFFAOYSA-N
SMILES:CCCCCCC1=CC=C(S1)C2=CC(=NC=C2)C3=NC=CC(=C3)C4=CC=C(S4)CCCCCC
Synonyms:
  • 4,4'-Bis(5-Hexyl-2-Thienyl)-2,2'-Bipyridine
Found 5 products.