CymitQuimica logo

CAS 104774-94-9

:

Piperidine, 4-(3-fluorophenyl)-, hydrochloride (1:1)

Description:
Piperidine, 4-(3-fluorophenyl)-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring, which is a six-membered saturated heterocycle containing one nitrogen atom. The presence of a 3-fluorophenyl group indicates that a fluorine atom is substituted on the phenyl ring at the meta position relative to the piperidine attachment. As a hydrochloride salt, it is typically encountered in a crystalline form and is soluble in water, which enhances its utility in various chemical applications. This compound may exhibit biological activity, making it of interest in medicinal chemistry and pharmacology. Its structure suggests potential interactions with biological targets, and it may be investigated for its effects in various therapeutic contexts. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken. Overall, Piperidine, 4-(3-fluorophenyl)-, hydrochloride is a notable compound in the realm of organic chemistry and drug development.
Formula:C11H14FN·ClH
InChI:InChI=1S/C11H14FN.ClH/c12-11-3-1-2-10(8-11)9-4-6-13-7-5-9;/h1-3,8-9,13H,4-7H2;1H
InChI key:InChIKey=KZWKZINPPPZZCE-UHFFFAOYSA-N
SMILES:FC=1C=C(C=CC1)C2CCNCC2.Cl
Synonyms:
  • 4-(3-Fluorophenyl)piperidine hydrochloride (1:1)
  • Piperidine, 4-(3-fluorophenyl)-, hydrochloride
  • Piperidine, 4-(3-fluorophenyl)-, hydrochloride (1:1)
Found 4 products.