CymitQuimica logo

CAS 104775-65-7

:

Morpholine, 4-(3-aminobenzoyl)-

Description:
Morpholine, 4-(3-aminobenzoyl)-, also known by its CAS number 104775-65-7, is a chemical compound that features a morpholine ring substituted with a 3-aminobenzoyl group. This structure imparts unique properties to the molecule, making it of interest in various chemical and pharmaceutical applications. Morpholine itself is a six-membered heterocyclic compound containing one oxygen and one nitrogen atom, which contributes to its basicity and ability to form hydrogen bonds. The presence of the 3-aminobenzoyl moiety enhances its potential for interactions with biological targets, possibly influencing its activity as a drug candidate or in other applications. Morpholine derivatives are often studied for their roles in medicinal chemistry, particularly due to their ability to act as intermediates in the synthesis of more complex molecules. Additionally, the compound may exhibit specific solubility characteristics and reactivity patterns, which are essential for its practical applications in research and industry. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.
Formula:C11H14N2O2
InChI:InChI=1S/C11H14N2O2/c12-10-3-1-2-9(8-10)11(14)13-4-6-15-7-5-13/h1-3,8H,4-7,12H2
InChI key:RFFVEVKGZGRRCP-UHFFFAOYSA-N
SMILES:C1COCCN1C(=O)C2=CC(=CC=C2)N
Found 3 products.