CAS 10479-30-8
:N,N-Bis(phenylmethyl)acetamide
Description:
N,N-Bis(phenylmethyl)acetamide, with the CAS number 10479-30-8, is an organic compound characterized by its amide functional group. It features two phenylmethyl groups (benzyl groups) attached to the nitrogen atom of the acetamide structure. This compound typically appears as a white to off-white solid and is soluble in organic solvents such as dichloromethane and ethanol, but has limited solubility in water due to its hydrophobic phenyl groups. The presence of the acetamide moiety contributes to its potential as a ligand in coordination chemistry and as an intermediate in organic synthesis. Its molecular structure allows for various interactions, making it of interest in fields such as pharmaceuticals and materials science. Additionally, the compound may exhibit interesting thermal and chemical stability, which can be advantageous in various applications. However, specific properties such as melting point, boiling point, and reactivity would need to be determined through experimental data or literature for precise applications.
Formula:C16H17NO
InChI:InChI=1/C16H17NO/c1-14(18)17(12-15-8-4-2-5-9-15)13-16-10-6-3-7-11-16/h2-11H,12-13H2,1H3
InChI key:InChIKey=JJGMIJNIKHHXHK-UHFFFAOYSA-N
SMILES:N(CC1=CC=CC=C1)(CC2=CC=CC=C2)C(C)=O
Synonyms:- Dibenzylacetamide
- N,N-Dibenzylacetamide
- Acetamide, N,N-dibenzyl-
- N,N-Bis(phenylmethyl)acetamide
- Acetamide, N,N-bis(phenylmethyl)-
- BRN 2109901
- n-Acetyldibenzylamine
- 4-12-00-02232 (Beilstein Handbook Reference)
- AI3-07700
- 1-(Propylsulfonyl)pyrrolidine
- Einecs 233-977-9
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
N,N-bis(phenylmethyl)acetamide
CAS:Formula:C16H17NOPurity:97%Color and Shape:LiquidMolecular weight:239.3123Dibenzylaminemonoacetate
CAS:Dibenzylaminemonoacetate is a hydroxy fatty acid that can be found in adipose tissue. It is an acylation reaction product of a fatty acid and aminoacetaldehyde, which is derived from the hydrolysis of the amino acid L-phenylalanine. Dibenzylaminemonoacetate has been shown to have anti-inflammatory effects in vitro and in vivo by activating PPARγ. When tested in mice, this compound was found to decrease levels of pro-inflammatory cytokines such as IL-1β, IL-6, and TNFα, while increasing levels of anti-inflammatory cytokines such as IL-10 and TGFβ. The mechanism behind these effects is not yet known but may be due to dibenzylaminemonoacetate’s ability to bind to amine groups on proteins or its ability to act as an antagonist for the α2A adrenergic receptor.Formula:C16H17NOPurity:Min. 95%Molecular weight:239.32 g/mol




