CymitQuimica logo

CAS 104802-53-1

:

ethyl 4-formylcyclohexane-1-carboxylate

Description:
Ethyl 4-formylcyclohexane-1-carboxylate, with the CAS number 104802-53-1, is an organic compound characterized by its unique structure, which includes a cyclohexane ring substituted with both a formyl group and an ethyl ester group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is soluble in organic solvents, such as ethanol and ether, but has limited solubility in water due to its hydrophobic cyclohexane framework. Ethyl 4-formylcyclohexane-1-carboxylate may exhibit reactivity typical of aldehydes and esters, making it useful in various organic synthesis applications, including the preparation of more complex molecules. Its functional groups allow for potential participation in nucleophilic addition reactions and esterification processes. Additionally, the compound's structural features may impart specific physical properties, such as boiling point and melting point, which are influenced by intermolecular forces like van der Waals interactions and hydrogen bonding. Overall, this compound serves as a valuable intermediate in synthetic organic chemistry.
Formula:C10H16O3
InChI:InChI=1/C10H16O3/c1-2-13-10(12)9-5-3-8(7-11)4-6-9/h7-9H,2-6H2,1H3
InChI key:InChIKey=PRZDWMBBAYQZOR-KYZUINATNA-N
SMILES:C(OCC)(=O)[C@H]1CC[C@H](C=O)CC1
Synonyms:
  • Ethyl trans-4-formylcyclohexanecarboxylate
  • trans-4-Formylcyclohexanecarboxylic acid ethyl ester
  • Cyclohexanecarboxylic acid, 4-formyl-, ethyl ester, trans-
  • Ethyl trans-formylcyclohexanecarboxylate
Found 5 products.