CymitQuimica logo

CAS 1048486-24-3

:

5-(3,5-DiMethylphenyl)nicotinic acid

Description:
5-(3,5-Dimethylphenyl)nicotinic acid is an organic compound characterized by its structure, which includes a nicotinic acid moiety substituted with a 3,5-dimethylphenyl group. This compound features a pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom, contributing to its basicity and potential interactions in biological systems. The presence of the carboxylic acid functional group (-COOH) in nicotinic acid imparts acidic properties, while the dimethylphenyl substituent enhances its lipophilicity and may influence its biological activity. This compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry and drug development. Its molecular structure allows for potential interactions with biological targets, including receptors and enzymes. Additionally, the compound's solubility, stability, and reactivity can be influenced by the presence of the dimethyl groups, which can affect its overall behavior in different environments. As with many organic compounds, its synthesis, characterization, and potential applications are subjects of ongoing research in the fields of chemistry and pharmacology.
Formula:C14H13NO2
InChI:InChI=1S/C14H13NO2/c1-9-3-10(2)5-11(4-9)12-6-13(14(16)17)8-15-7-12/h3-8H,1-2H3,(H,16,17)
InChI key:YLLORROYVZRDMN-UHFFFAOYSA-N
SMILES:CC1=CC(=CC(=C1)C2=CC(=CN=C2)C(=O)O)C
Synonyms:
  • 5-(3,5-Dimethylphenyl)-3-pyridinecarboxylic acid
  • 3-Pyridinecarboxylic acid, 5-(3,5-dimethylphenyl)-
  • 5-(3,5-DiMethylphenyl)nicotinic acid
Found 1 products.