CymitQuimica logo

CAS 10486-46-1

:

4-AMINO-2,3,5-TRIMETHYL-PHENOL

Description:
4-Amino-2,3,5-trimethyl-phenol, with the CAS number 10486-46-1, is an organic compound characterized by the presence of an amino group and multiple methyl substituents on a phenolic ring. This compound typically appears as a solid at room temperature and is soluble in organic solvents, reflecting its aromatic nature. The amino group contributes to its basicity and potential reactivity, while the trimethyl substitutions influence its steric properties and hydrophobicity. It may exhibit antioxidant properties due to the presence of the phenolic hydroxyl group, making it of interest in various applications, including as a potential intermediate in organic synthesis or in the formulation of dyes and pigments. Additionally, the compound's structure suggests it could participate in hydrogen bonding, affecting its solubility and interaction with other molecules. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.
Formula:C9H13NO
InChI:InChI=1S/C9H13NO/c1-5-4-8(11)6(2)7(3)9(5)10/h4,11H,10H2,1-3H3
InChI key:NMSCVRBXXWPFSK-UHFFFAOYSA-N
SMILES:CC1=CC(=C(C(=C1N)C)C)O
Found 3 products.