CymitQuimica logo

CAS 10486-51-8

:

Benzoic acid, 4-(chlorosulfonyl)-, ethyl ester

Description:
Benzoic acid, 4-(chlorosulfonyl)-, ethyl ester, also known by its CAS number 10486-51-8, is an organic compound characterized by the presence of a benzoic acid moiety with a chlorosulfonyl group and an ethyl ester functional group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is known for its reactivity due to the presence of the chlorosulfonyl group, which can participate in various chemical reactions, including nucleophilic substitutions. The ethyl ester component contributes to its solubility in organic solvents, making it useful in various chemical syntheses and applications. Additionally, this compound may exhibit properties such as moderate toxicity and potential environmental impact, necessitating careful handling and disposal. Its applications can range from use in organic synthesis to potential roles in pharmaceuticals or agrochemicals, although specific uses may vary based on regulatory approvals and market demand.
Formula:C9H9ClO4S
InChI:InChI=1S/C9H9ClO4S/c1-2-14-9(11)7-3-5-8(6-4-7)15(10,12)13/h3-6H,2H2,1H3
InChI key:InChIKey=MRNJSMNKWNPSDN-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1=CC=C(S(Cl)(=O)=O)C=C1
Synonyms:
  • 4-(Ethoxycarbonyl)benzenesulfonyl chloride
  • Benzoic Acid, 4-(Chlorosulfonyl)-, Ethyl Ester
  • Benzoic acid, p-(chlorosulfonyl)-, ethyl ester
  • Ethyl 4-(chlorosulfonyl)benzoate
  • Ethyl 4-chlorosulfonylbenzoate
Found 3 products.