CymitQuimica logo

CAS 10487-31-7

:

1-ISOPROPYL-1H-INDOLE-2,3-DIONE

Description:
1-Isopropyl-1H-indole-2,3-dione, with the CAS number 10487-31-7, is a chemical compound that belongs to the indole family, characterized by its bicyclic structure containing a fused benzene and pyrrole ring. This compound features a ketone functional group, which contributes to its reactivity and potential applications in organic synthesis. The isopropyl group attached to the indole structure enhances its lipophilicity, influencing its solubility and interaction with biological systems. Typically, compounds of this nature may exhibit interesting pharmacological properties, making them of interest in medicinal chemistry. The presence of the indole moiety is often associated with various biological activities, including anti-inflammatory and anticancer effects. Additionally, the compound's stability and reactivity can be influenced by the presence of substituents on the indole ring, which can affect its electronic properties. Overall, 1-isopropyl-1H-indole-2,3-dione represents a versatile scaffold for further chemical exploration and potential therapeutic development.
Formula:C11H11NO2
InChI:InChI=1/C11H11NO2/c1-7(2)12-9-6-4-3-5-8(9)10(13)11(12)14/h3-7H,1-2H3
SMILES:CC(C)N1c2ccccc2C(=O)C1=O
Synonyms:
  • Akos Bbs-00001001
  • 1-(propan-2-yl)-1H-indole-2,3-dione
Found 2 products.