CymitQuimica logo

CAS 104882-22-6

:

BOC-DL-1-NAPHTHYLALANINE

Description:
BOC-DL-1-NAPHTHYLALANINE, with the CAS number 104882-22-6, is a derivative of the amino acid phenylalanine, specifically modified to include a naphthyl group and a tert-butyloxycarbonyl (BOC) protecting group. This compound is characterized by its hydrophobic nature due to the presence of the naphthyl moiety, which contributes to its potential applications in peptide synthesis and drug development. The BOC group serves as a protective group for the amino functionality, allowing for selective reactions during synthetic processes. BOC-DL-1-NAPHTHYLALANINE is typically utilized in the synthesis of peptides where the naphthylalanine residue can impart unique structural and functional properties to the resulting peptides. Its solubility is generally influenced by the solvent used, with organic solvents often being more suitable due to its hydrophobic characteristics. Additionally, the compound's stability and reactivity can be affected by environmental conditions such as pH and temperature, making it important to consider these factors during handling and experimentation.
Formula:C18H21NO4
InChI:InChI=1/C18H21NO4/c1-18(2,3)23-17(22)19-15(16(20)21)11-13-9-6-8-12-7-4-5-10-14(12)13/h4-10,15H,11H2,1-3H3,(H,19,22)(H,20,21)
InChI key:KHHIGWRTNILXLL-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=NC(Cc1cccc2ccccc12)C(=O)O)O
Synonyms:
  • 2-Tert-Butoxycarbonylamino-3-Naphthalen-1-Yl-Propionic Acid
  • 3-(Naphthalen-1-Yl)-N-Boc-Dl-Alanine
  • N-(tert-butoxycarbonyl)-3-naphthalen-1-ylalanine
Found 3 products.