CAS 10489-28-8
:2,3-DIHYDRO-2,2-DIMETHYLINDEN-1-ONE
Description:
2,3-Dihydro-2,2-dimethylinden-1-one, with the CAS number 10489-28-8, is an organic compound characterized by its bicyclic structure, which includes a fused indene framework. This compound features a ketone functional group, contributing to its reactivity and potential applications in organic synthesis. It is typically a colorless to pale yellow liquid or solid, depending on its purity and temperature. The presence of the dimethyl groups enhances its steric hindrance, influencing its chemical behavior and interactions. This compound is of interest in various fields, including pharmaceuticals and materials science, due to its unique structural properties. Its reactivity can be attributed to the carbonyl group, making it a potential candidate for further chemical transformations. Additionally, 2,3-dihydro-2,2-dimethylinden-1-one may exhibit interesting physical properties, such as solubility in organic solvents, which can be useful in various applications. However, specific handling and safety measures should be observed, as with any chemical substance, to ensure safe usage in laboratory settings.
Formula:C11H12O
InChI:InChI=1/C11H12O/c1-11(2)7-8-5-3-4-6-9(8)10(11)12/h3-6H,7H2,1-2H3
SMILES:CC1(C)Cc2ccccc2C1=O
Synonyms:- 1H-inden-1-one, 2,3-dihydro-2,2-dimethyl-
- 2,2-Dimethylindan-1-one
- 2,2-dimethyl-2,3-dihydro-1H-inden-1-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
2,2-Dimethyl-2,3-dihydro-1H-inden-1-one
CAS:2,2-Dimethyl-2,3-dihydro-1H-inden-1-oneFormula:C11H12OPurity:98%Molecular weight:160.222,2-Dimethyl-2,3-dihydro-1H-inden-1-one
CAS:2,2-Dimethyl-2,3-dihydro-1H-inden-1-oneFormula:C11H12OPurity:98%Molecular weight:160.212,2-Dimethyl-3H-inden-1-one
CAS:Formula:C11H12OPurity:98%Color and Shape:SolidMolecular weight:160.21242,2-Dimethyl-1-indanone
CAS:Controlled ProductFormula:C11H12OColor and Shape:NeatMolecular weight:160.2122,2-Dimethyl-1-indanone
CAS:2,2-Dimethyl-1-indanone is a carbonyl group with an aromatic hydrocarbon that has been shown to have anti-inflammatory properties. It has been found in the blood of patients with inflammatory bowel disease and also in Alzheimer's disease patients. This active methylene is a pyrimidine compound that has been shown to be useful in the synthesis of polymers used in copolymerization and condensation reactions. The compound can also be used as an intermediate for drugs against bowel diseases or Alzheimer's disease.Formula:C11H12OPurity:Min. 95%Molecular weight:160.21 g/mol





