CAS 10489-75-5

2,3-Dihydro-1,4-dithiino[2,3-c]furan-5,7-dione

Description:

2,3-Dihydro-1,4-dithiino[2,3-c]furan-5,7-dione, with CAS number 10489-75-5, is a heterocyclic compound characterized by its unique fused ring structure that incorporates both sulfur and oxygen atoms. This compound features a dithiino framework, which contributes to its potential reactivity and stability. The presence of the furan ring indicates that it may exhibit aromatic properties, while the dione functional groups suggest it can participate in various chemical reactions, including nucleophilic attacks and oxidation-reduction processes. Its molecular structure allows for potential applications in organic synthesis and materials science, particularly in the development of novel compounds with specific electronic or photonic properties. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry. However, detailed studies on its physical properties, such as solubility, melting point, and spectral characteristics, would be necessary to fully understand its behavior and potential applications in various fields.

Formula: C₆H₄O₃S₂

InChI: InChI=1S/C6H4O3S2/c7-5-3-4(6(8)9-5)11-2-1-10-3/h1-2H2

InChI key: InChIKey=MXSSHXZXAAXCOW-UHFFFAOYSA-N

SMILES: O=C1C2=C(C(=O)O1)SCCS2

Synonyms:

• 1,4-Dithiino[2,3-c]furan-5,7-dione, 2,3-dihydro-
• 2,3-Dihydro-1,4-dithiino(2,3-c)furan-5,7-dione
• 3,6-Dithiacyclohexene-1,2-dicarboxylic acid anhydride
• 3,6-Dithiacyclohexene-1,2-dicarboxylic anhydride
• 2,3-Dihydro-1,4-dithiino[2,3-c]furan-5,7-dione
• p-Dithiin-2,3-dicarboxylic anhydride, 5,6-dihydro-

2,3-Dihydro-1,4-dithiino[2,3-c]furan-5,7-dione

CAS: 10489-75-5

Formula: C₆H₄O₃S₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 188.2242

Ref: IN-DA003FIQ

2,3-Dihydro-1,4-dithiino[2,3-c]furan-5,7-dione

CAS: 10489-75-5

2,3-Dihydro-1,4-dithiino[2,3-c]furan-5,7-dione

Purity: 95%

Molecular weight: 188.23g/mol

Ref: 54-OR1002884

2,3-Dihydro-1,4-dithiino[2,3-c]furan-5,7-dione

CAS: 10489-75-5

Purity: 98.0%

Color and Shape: Solid

Molecular weight: 188.22000122070312

Ref: 10-F013526

2,3-Dihydro-1,4-dithiino[2,3-c]furan-5,7-dione

CAS: 10489-75-5

2,3-Dihydro-1,4-dithiino[2,3-c]furan-5,7-dione is a coordination polymer that contains both an anhydride and a hydroxide group. It has been shown to form a coordination polymer with lithium hydroxide as the counterion. The topological spaces of the polymer are not limited by the size of the monomer unit. This coordination polymer has been shown to form through reaction with lithium hydroxide in water at room temperature.

Formula: C₆H₄O₃S₂

Purity: Min. 95%

Color and Shape: Slightly Yellow Powder

Molecular weight: 188.22 g/mol

Ref: 3D-FD00362