CymitQuimica logo

CAS 10489-75-5

:

2,3-Dihydro-1,4-dithiino[2,3-c]furan-5,7-dione

Description:
2,3-Dihydro-1,4-dithiino[2,3-c]furan-5,7-dione, with CAS number 10489-75-5, is a heterocyclic compound characterized by its unique fused ring structure that incorporates both sulfur and oxygen atoms. This compound features a dithiino framework, which contributes to its potential reactivity and stability. The presence of the furan ring indicates that it may exhibit aromatic properties, while the dione functional groups suggest it can participate in various chemical reactions, including nucleophilic attacks and oxidation-reduction processes. Its molecular structure allows for potential applications in organic synthesis and materials science, particularly in the development of novel compounds with specific electronic or photonic properties. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry. However, detailed studies on its physical properties, such as solubility, melting point, and spectral characteristics, would be necessary to fully understand its behavior and potential applications in various fields.
Formula:C6H4O3S2
InChI:InChI=1S/C6H4O3S2/c7-5-3-4(6(8)9-5)11-2-1-10-3/h1-2H2
InChI key:InChIKey=MXSSHXZXAAXCOW-UHFFFAOYSA-N
SMILES:O=C1C2=C(C(=O)O1)SCCS2
Synonyms:
  • 1,4-Dithiino[2,3-c]furan-5,7-dione, 2,3-dihydro-
  • 2,3-Dihydro-1,4-dithiino(2,3-c)furan-5,7-dione
  • 3,6-Dithiacyclohexene-1,2-dicarboxylic acid anhydride
  • 3,6-Dithiacyclohexene-1,2-dicarboxylic anhydride
  • 2,3-Dihydro-1,4-dithiino[2,3-c]furan-5,7-dione
  • p-Dithiin-2,3-dicarboxylic anhydride, 5,6-dihydro-
Found 4 products.