CAS 1048917-20-9
:4-Piperidinecarboxylicacid, 1-(5-methyl-2-benzoxazolyl)-
Description:
4-Piperidinecarboxylic acid, 1-(5-methyl-2-benzoxazolyl)-, identified by its CAS number 1048917-20-9, is a chemical compound that features a piperidine ring substituted with a carboxylic acid group and a benzoxazole moiety. This compound is characterized by its potential biological activity, which may include roles in medicinal chemistry or as a pharmacophore in drug development. The presence of the piperidine ring contributes to its basicity and solubility in polar solvents, while the benzoxazole structure may impart specific interactions with biological targets due to its aromatic nature. The compound's molecular structure suggests it could participate in hydrogen bonding and π-π stacking interactions, which are significant in biological systems. Additionally, its functional groups may influence its reactivity and stability under various conditions. Overall, this compound's unique structural features make it of interest in research, particularly in the fields of organic synthesis and pharmaceutical applications.
Formula:C14H16N2O3
InChI:InChI=1S/C14H16N2O3/c1-9-2-3-12-11(8-9)15-14(19-12)16-6-4-10(5-7-16)13(17)18/h2-3,8,10H,4-7H2,1H3,(H,17,18)
InChI key:DOQBYCONUAYJOK-UHFFFAOYSA-N
SMILES:CC1=CC2=C(C=C1)OC(=N2)N3CCC(CC3)C(=O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1-(5-Methylbenzo[d]oxazol-2-yl)piperidine-4-carboxylic acid
CAS:Formula:C14H16N2O3Molecular weight:260.2884
