CymitQuimica logo

CAS 1049004-32-1

:

Ethyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-cyclohexene-1-carboxylate

Description:
Ethyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-cyclohexene-1-carboxylate is an organic compound characterized by its unique structure, which includes a cyclohexene ring and a dioxaborolane moiety. This compound features a carboxylate ester functional group, contributing to its reactivity and potential applications in organic synthesis. The presence of the dioxaborolane group suggests that it may participate in boron-mediated reactions, making it useful in various synthetic pathways, particularly in the formation of carbon-carbon bonds. The tetramethyl substituents enhance its steric properties, potentially influencing its reactivity and solubility. Ethyl esters are generally known for their pleasant odors and moderate volatility, which may also apply to this compound. Its specific applications could range from pharmaceuticals to materials science, depending on its reactivity and the functional groups present. As with many organic compounds, safety data and handling precautions should be considered, particularly regarding its potential reactivity and toxicity.
Formula:C15H25BO4
InChI:InChI=1S/C15H25BO4/c1-6-18-13(17)11-7-9-12(10-8-11)16-19-14(2,3)15(4,5)20-16/h9,11H,6-8,10H2,1-5H3
InChI key:ZREZDODZGZVRBD-UHFFFAOYSA-N
SMILES:CCOC(=O)C1CC=C(CC1)B1OC(C)(C)C(C)(C)O1
Found 4 products.