CAS 104931-56-8
:Benzoic acid, 2-[[3-(3,4-dimethoxyphenyl)-1-oxo-2-propenyl]amino]-,monosodium salt
Description:
Benzoic acid, 2-[[3-(3,4-dimethoxyphenyl)-1-oxo-2-propenyl]amino]-, monosodium salt, commonly referred to by its CAS number 104931-56-8, is a chemical compound characterized by its structural complexity and functional groups. It features a benzoic acid moiety, which contributes to its acidity and potential for forming salts. The presence of a monosodium salt indicates that it can exist in a soluble form, enhancing its utility in various applications. The compound contains a propenyl group linked to an amino group, which suggests potential reactivity and biological activity. The dimethoxyphenyl substituent may impart specific electronic properties, influencing its interactions in biological systems. This compound may exhibit antimicrobial or antifungal properties, making it of interest in pharmaceutical and agricultural applications. Its solubility in water, stability under various conditions, and potential for forming complexes with other molecules are important characteristics that define its behavior in chemical and biological contexts. Overall, this compound represents a unique intersection of organic chemistry and potential therapeutic applications.
Formula:C18H16NNaO5
InChI:InChI=1S/C18H17NO5.Na/c1-23-15-9-7-12(11-16(15)24-2)8-10-17(20)19-14-6-4-3-5-13(14)18(21)22;/h3-11H,1-2H3,(H,19,20)(H,21,22);/q;+1/p-1/b10-8+;
InChI key:KZGHWWBBHZLTTA-VRTOBVRTSA-M
SMILES:COC1=C(C=C(C=C1)/C=C/C(=O)NC2=CC=CC=C2C(=O)[O-])OC.[Na+]
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Sodium 2-(3-(3,4-dimethoxyphenyl)acrylamido)benzoate
CAS:Sodium 2-(3-(3,4-dimethoxyphenyl)acrylamido)benzoateFormula:C18H16NNaO5Purity:98+%Molecular weight:349.32Tranilast sodium
CAS:Sodium 2-(3-(3,4-dimethoxyphenyl)acrylamido)benzoateFormula:C18H16NNaO5Purity:98+%Molecular weight:349.31Tranilast sodium
CAS:Tranilast sodium is an ophthalmic medicine that is used to treat sensitivity and inflammation of the cornea. It belongs to the class of anti-inflammatory drugs. Tranilast sodium is a non-steroidal anti-inflammatory drug, which works by blocking the release of certain substances in cells that are responsible for causing pain and inflammation. This medication has been shown to be effective in treating squamous cell carcinoma of the eye. Tranilast sodium has also been shown to reduce corneal epithelium disease process and metaplasia, and improve corneal sensitivity parameters.
Formula:C18H16NNaO5Purity:Min. 95%Molecular weight:349.3 g/molTranilast Sodium
CAS:Tranilast Sodium has been used for the treatment of bronchial asthma. Tranilast is also used to autoimmune diseases, atopic and fibrotic pat.Formula:C18H17NNaO5Purity:98%Color and Shape:SolidMolecular weight:350.32




