CymitQuimica logo

CAS 10494-82-3

:

2-Amino-N-butylbenzamide

Description:
2-Amino-N-butylbenzamide, with the CAS number 10494-82-3, is an organic compound characterized by the presence of an amine group and an amide functional group attached to a butyl chain and a benzene ring. This compound typically exhibits properties associated with both amines and amides, such as moderate solubility in polar solvents due to the presence of the amide group, which can engage in hydrogen bonding. The butyl group contributes to its hydrophobic characteristics, influencing its overall solubility profile. The amino group can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, making it a versatile intermediate in organic synthesis. Additionally, the compound may exhibit biological activity, which could be relevant in pharmaceutical applications. Its melting and boiling points, as well as its stability under various conditions, would depend on the specific molecular interactions and the environment in which it is placed. Overall, 2-Amino-N-butylbenzamide is a compound of interest in both synthetic chemistry and potential medicinal chemistry applications.
Formula:C11H16N2O
InChI:InChI=1S/C11H16N2O/c1-2-3-8-13-11(14)9-6-4-5-7-10(9)12/h4-7H,2-3,8,12H2,1H3,(H,13,14)
InChI key:InChIKey=MXZDMUOYQBHOCH-UHFFFAOYSA-N
SMILES:C(NCCCC)(=O)C1=C(N)C=CC=C1
Synonyms:
  • 2-Amino-N-(n-butyl)benzamide
  • 2-Amino-N-butylbenzamide
  • Benzamide, 2-amino-N-butyl-
  • Benzamide, o-amino-N-butyl-
  • N-Butyl-o-aminobenzamide
  • NSC 88051
Found 4 products.