CymitQuimica logo

CAS 10495-73-5

:

6-BROMO-2,2'-BIPYRIDINE

Description:
6-Bromo-2,2'-bipyridine is an organic compound characterized by its bipyridine structure, which consists of two pyridine rings connected by a carbon-carbon bond. The presence of a bromine atom at the 6-position of one of the pyridine rings introduces notable reactivity and influences its chemical properties. This compound is typically a solid at room temperature and is soluble in polar organic solvents. It is often used as a ligand in coordination chemistry due to its ability to form complexes with various metal ions, enhancing its utility in catalysis and materials science. Additionally, 6-bromo-2,2'-bipyridine can participate in various chemical reactions, including nucleophilic substitutions and cross-coupling reactions, making it valuable in synthetic organic chemistry. Safety precautions should be observed when handling this compound, as it may pose health risks if ingested or inhaled. Overall, its unique structural features and reactivity profile make it a significant compound in both academic and industrial research settings.
Formula:C10H7BrN2
InChI:InChI=1/C10H7BrN2/c11-10-6-3-5-9(13-10)8-4-1-2-7-12-8/h1-7H
InChI key:NCRIDSGPLISUEU-UHFFFAOYSA-N
SMILES:c1ccnc(c1)c1cccc(Br)n1
Synonyms:
  • 2-Bromo-6-(2-Pyridyl)Pyridine
Found 7 products.