CymitQuimica logo

CAS 1049677-32-8

:

8-chloro-3-iodoimidazo[1,2-a]pyrazine

Description:
8-Chloro-3-iodoimidazo[1,2-a]pyrazine is a heterocyclic compound characterized by its imidazo[1,2-a]pyrazine core, which consists of fused imidazole and pyrazine rings. The presence of chlorine and iodine substituents at the 8 and 3 positions, respectively, contributes to its unique chemical properties and potential reactivity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of halogen atoms that can influence biological activity and molecular interactions. Additionally, the imidazo[1,2-a]pyrazine framework is known for its role in various biological systems, making this compound of interest for research in drug discovery and development. Safety and handling precautions should be observed, as halogenated compounds can pose health risks. Overall, 8-chloro-3-iodoimidazo[1,2-a]pyrazine represents a valuable compound for further investigation in chemical and biological research.
Formula:C6H3ClIN3
InChI:InChI=1S/C6H3ClIN3/c7-5-6-10-3-4(8)11(6)2-1-9-5/h1-3H
InChI key:RHQCTVNTDPLROD-UHFFFAOYSA-N
SMILES:C1=CN2C(=CN=C2C(=N1)Cl)I
Found 4 products.